| Identification | |
| Name: | 2-Oxiraneoctanoic acid,3-octyl-, 2-propen-1-yl ester |
| Synonyms: | Octadecanoicacid, 9,10-epoxy-, allyl ester (6CI,7CI,8CI); Oxiraneoctanoic acid, 3-octyl-,2-propenyl ester (9CI); Allyl epoxystearate; NSC 83539 |
| CAS: | 123-36-4 |
| Molecular Formula: | C21H38 O3 |
| Molecular Weight: | 338.59 |
| InChI: | InChI=1/C21H38O3/c1-3-5-6-7-9-12-15-19-20(24-19)16-13-10-8-11-14-17-21(22)23-18-4-2/h4,19-20H,2-3,5-18H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 160.5°C |
| Boiling Point: | 420.7°Cat760mmHg |
| Density: | 0.925g/cm3 |
| Refractive index: | 1.461 |
| Specification: |
Allyl-9,10-epoxystearate , its cas register number is 123-36-4. It also can be called 9,10-Epoxystearic acid, allyl ester ; Octadecanoic acid, 9,10-epoxy-, allyl ester (8CI) ; and Stearic acid, 9,10-epoxy-, allyl ester . |
| Flash Point: | 160.5°C |
| Safety Data | |
 |
|
