| Identification |
| Name: | 3-Methyl-1-butanol |
| Synonyms: | Isoamyl alcohol; Isopentanol; Isopentyl alcohol; 3-methyl-1-butanol free of furfurol for fat determination; Methylbutanol,98%; (1S-exo, exo-3-(N-(3,5-Dimethylphenyl)Benzenesulfonamide)iso-Borneol; Natural Isoamyl Alcohol; Natural 3-methylbutanol |
| CAS: | 123-51-3 |
| EINECS: | 204-633-5 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1201/1105 |
| Density: | 0.809 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong acids, acid chlorides, acid anhydrides. |
| Refractive index: | 1.405-1.407 |
| Solubility: | Water Solubility :25 g/L (20 oC) |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| HS Code: | 29335995 |
| Storage Temperature: | Flammables area |
| Color: | <20(APHA) |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
