| Identification |
| Name: | Paraldehyde |
| Synonyms: | 2,4,6-trimethyl-1,3,5-Trioxane; 2,4,6-trimethyl-s-trioxane; paraacetaldehyde; Paracetaldehyde; PARAL; acetaldehyde, trimer; elaldehyde; PCHO; s-trimethyltrioxymethylene; trimethyl 1,3,5-trioxane; |
| CAS: | 123-63-7 |
| EINECS: | 204-639-8 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-4-7-5(2)9-6(3)8-4/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1264 |
| Density: | 0.992 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, mineral acids. |
| Refractive index: | 1.4035-1.4055 |
| Solubility: | 125 g/L (25 ºC) |
| Appearance: | Colourless to yellowish clear liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | COLORLESS, TRANSPARENT LIQUID |
| Usage: | Paraldehyde is used as solvent for fats, oils, waxes, rubber and resins; as substitute for acetaldehyde; as intermediate for organic chemicals, dyestuffs, accelerators for vulcanizations, rubber oxidants, etc. Product Data Sheet |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
