| Identification | |
| Name: | Butyl acetate |
| CAS: | 123-86-4 |
| EINECS: | 204-658-1 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1123 |
| Density: | 0.88 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Refractive index: | 1.393-1.395 |
| Appearance: | colourless liquid with a fruity odor |
| Specification: |
n-Butyl acetate , its cas register number is 123-86-4. It also can be called Acetic acid, butyl ester ; Butyl acetate ; 1-Butyl acetate ; Acetic acid n-butyl ester ; Acetic acid, butyl ester ; n-Butyl acetate ; n-Butyl acetate (natural) ; n-Butyl ethanoate .It is a colourless liquid with a fruity odor. It is highly flammable and very slightly soluble in water. It is an ester. It is found in many types of fruit, where along with other chemicals it imparts characteristic flavors. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
