Identification |
Name: | 6H-Pyrido[2,3-b][1,4]benzodiazepin-6-one,11-[2-[4-[4-(diethylamino)butyl]-1-piperidinyl]acetyl]-5,11-dihydro- |
Synonyms: | 6H-Pyrido[2,3-b][1,4]benzodiazepin-6-one,11-[[4-[4-(diethylamino)butyl]-1-piperidinyl]acetyl]-5,11-dihydro- (9CI); AQ-RA741 |
CAS: | 123548-16-3 |
Molecular Formula: | C27H37 N5 O2 |
Molecular Weight: | 463.61498 |
InChI: | InChI=1/C27H37N5O2/c1-3-30(4-2)17-8-7-10-21-14-18-31(19-15-21)20-25(33)32-24-13-6-5-11-22(24)27(34)29-23-12-9-16-28-26(23)32/h5-6,9,11-13,16,21H,3-4,7-8,10,14-15,17-20H2,1-2H3,(H,29,34) |
Molecular Structure: |
|
Properties |
Flash Point: | 318.3°C |
Boiling Point: | 602.7°Cat760mmHg |
Density: | 1.132g/cm3 |
Refractive index: | 1.566 |
Biological Activity: | High affinity, selective muscarinic M 2 receptor antagonist (pK i values are 8.3, 7.7 and 6.82 for M 2 , M 1 and M 3 receptors, respectively). In vivo, displays cardioselectivity over intestinal, tracheal and bladder muscarinic receptors; inhibits vagally and agonist-induced bradycardia. |
Flash Point: | 318.3°C |
Safety Data |
|
|