| Identification |
| Name: | Ethanimidamide,hydrochloride (1:1) |
| Synonyms: | Acetamidine,hydrochloride (6CI,7CI);Acetamidine, monohydrochloride (8CI);Ethanimidamide,monohydrochloride (9CI);Acetamidinium chloride;Acetimidinium chloride;Ethanamidine hydrochloride;Ethanimidamide,hydrochloride;Methylamidine hydrochloride;SN 4455;a-Amino-a-iminoethanehydrochloride;Ethanimidamide, Monohydrochloride; |
| CAS: | 124-42-5 |
| EINECS: | 204-700-9 |
| Molecular Formula: | C2H6N2.HCl |
| Molecular Weight: | 94.54 |
| InChI: | InChI=1/C2H6N2.ClH/c1-2(3)4;/h1H3,(H3,3,4);1H |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.458 |
| Water Solubility: | 1 g/mL |
| Solubility: | 1 g/mL |
| Appearance: | Colorless to white solid. |
| HS Code: | 29252000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
