| Identification | |
| Name: | Chlorodibromomethane |
| Synonyms: | Dibromochloromethane |
| CAS: | 124-48-1 |
| EINECS: | 2810 |
| Molecular Formula: | CHBr2Cl |
| Molecular Weight: | 208.27 |
| InChI: | InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 2810 |
| Density: | 2.451 |
| Refractive index: | n20/D 1.547(lit.) |
| Solubility: | > 10% in acetone; > 10% in benzene; > 10% in ethyl ether; > 10% in ethanol Soluble in ethanol, ethyl ether, benzene, carbon tetrachloride, organic solvents, and acetone Miscible in organic solvents. In water, 2.70X10+3 mg/L at 20 deg C [Heikes DL; J Assoc Off Anal Chem 70: 215-226 (1987)] PubMed Abstract |
| Appearance: | Pale yellow heavy liquid. |
| Specification: |
Chemical Properties:Chlorodibromomethane (124-48-1) clear light yellow to orange liquid . |
| Report: |
. |
| Packinggroup: | III |
| Flash Point: | 2810 |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture & Light Sensitive |
| Color: | Colorless to pale yellow liquid Clear, colorless, heavy liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
