| Identification | |
| Name: | Phenol,3,5,?-trimethyl-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, 2,3,5(or 3,4,5)-trimethylphenyl ester (8CI); Phenol, 2,3,5(or3,4,5)-trimethyl-, methylcarbamate (9CI); Broot; Landrin; Trimethacarb |
| CAS: | 12407-86-2 |
| Molecular Formula: | C11H15 N O2 |
| Molecular Weight: | 193.27 |
| InChI: | InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.9°C |
| Boiling Point: | 287.8°Cat760mmHg |
| Density: | 1.046g/cm3 |
| Specification: |
Trimethacarb , its cas register number is 12407-86-2. It also can be called Trimethylphenyl methylcarbamate ; Carbamic acid, methyl-, 2,3,5(or 3,4,5)-trimethylphenyl ester ; and Phenol, 2,3,5(or 3,4,5)-trimethyl-, methylcarbamate (9CI) . |
| Flash Point: | 127.9°C |
| Safety Data | |
 |
|
