Identification |
Name: | 1(2H)-Naphthalenone,4-(3,4-dichlorophenyl)-3,4-dihydro-, (4S)- |
Synonyms: | 1(2H)-Naphthalenone,4-(3,4-dichlorophenyl)-3,4-dihydro-, (S)-;(4S)-(3,4-Dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone;(S)-4-(3,4-Dichlorophenyl)-1-tetralone;(S)-4-(3,4-Dichlorophenyl)-3,4-dihydro-1-naphthalenone; |
CAS: | 124379-29-9 |
EINECS: | 444-830-5 |
Molecular Formula: | C16H12Cl2O |
Molecular Weight: | 291.17 |
InChI: | InChI=1/C16H12Cl2O/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11H,6,8H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 840C |
Flash Point: | 170.3°C |
Boiling Point: | 403°C at 760 mmHg |
Density: | 1.318g/cm3 |
Refractive index: | 1.618 |
Appearance: | brown solid |
Flash Point: | 170.3°C |
Usage: | An intermediate in the synthesis of the drug Sertraline |
Safety Data |
|
 |