| Identification | |
| Name: | Pyridine,2-(chloromethyl)-4-methoxy-3-methyl- |
| Synonyms: | 2-Chloromethyl-4-methoxy-3-methylpyridine |
| CAS: | 124473-12-7 |
| Molecular Formula: | C8H10ClNO |
| Molecular Weight: | 208.09 |
| InChI: | InChI=1/C8H10ClNO/c1-6-7(5-9)10-4-3-8(6)11-2/h3-4H,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.537°C |
| Boiling Point: | 257.508°C at 760 mmHg |
| Density: | 1.139g/cm3 |
| Refractive index: | 1.518 |
| Appearance: | Light yellow liquid |
| Specification: |
2-(Chloromethyl)-4-methoxy-3-methylpyridine hydrochloride , its cas register number is 124473-12-7. It also can be called 2-(Chloromethyl)-4-methoxy-3-methylpyridine hydrochloride (1:1) ; and Pyridine, 2-(chloromethyl)-4-methoxy-3-methyl-, hydrochloride (1:1) . |
| Flash Point: | 109.537°C |
| Safety Data | |
 |
|
