| Identification | |
| Name: | Quinoline,8-chloro-4-(2-methylphenoxy)- |
| Synonyms: | 8-Chloro-4-(2-methylphenoxy)quinoline;quinoline, 8-chloro-4-(2-methylphenoxy)- |
| CAS: | 124496-00-0 |
| Molecular Formula: | C16H12 Cl N O |
| Molecular Weight: | 269.74 |
| InChI: | InChI=1/C16H12ClNO/c1-11-5-2-3-8-14(11)19-15-9-10-18-16-12(15)6-4-7-13(16)17/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.2°C |
| Boiling Point: | 402.5°Cat760mmHg |
| Density: | 1.251g/cm3 |
| Refractive index: | 1.647 |
| Specification: |
8-Chloro-4-(2-methylphenoxy)quinoline , with CAS number of 124496-00-0, can be called quinoline, 8-chloro-4-(2-methylphenoxy)- ; 8-Chloro-4-(2-methylphenoxy)quinoline . |
| Flash Point: | 197.2°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
