| Identification | |
| Name: | Valaciclovir |
| Synonyms: | 256U87;L-VACV;L-Valine ester with 9-[(2-hydroxyethoxy)methyl]guanine;ValACV;Valcivir;L-Valine,2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester; |
| CAS: | 124832-26-4 |
| Molecular Formula: | C13H21ClN6O4 |
| Molecular Weight: | 324.3357 |
| InChI: | InChI=1S/C13H20N6O4/c1-7(2)8(14)12(21)23-4-3-22-6-19-5-16-9-10(19)17-13(15)18-11(9)20/h5,7-8H,3-4,6,14H2,1-2H3,(H3,15,17,18,20)/t8-/m0/s1 |
| Molecular Structure: | ![(C13H21ClN6O4) 256U87;L-VACV;L-Valine ester with 9-[(2-hydroxyethoxy)methyl]guanine;ValACV;Valcivir;L-Valine,2-[(2-...](https://img.guidechem.com/casimg/124832-26-4.gif) |
| Properties | |
| Boiling Point: | RELATIVE DENSITY |
| Density: | 1.55 g/cm3 |
| Water Solubility: | 170 mg/ml |
| Solubility: | 170 mg/ml |
| Appearance: | white to off-white crystalline powder |
| Specification: |
?Valacyclovir hydrochloride ,its CAS NO. is 124832-26-4 ,the synonyms is l-Valine 2-[(2-amino-1,6-dihydro-6-oxo-9h-purin-9yl)methoxy]ethyl ester ; l-Valine 2-[(2-amino-1,6-dihydro-6-oxo-9h-purin-9yl)methoxy]ethyl ester, hydrochloride salt ; l-Valine 2-(guanin-9-ylmethoxy)ethyl ester ; Valaciclovir ; Valaciclovir hcl ; Valaciclovir hydrochloride ; Valacv ; Valacyclovir .?Its classification code are Anti-Infective Agents and Antiviral Agents. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
