Identification |
Name: | 3H-Pyrazol-3-one,4,4'-methylenebis[1,2-dihydro-1,5-dimethyl-2-phenyl- |
Synonyms: | Antipyrine,4,4'-methylenedi- (6CI,8CI);4,4'-Diantipyrylmethane;Bisantipyrylmethane;Diantipyrinylmethane;NSC 60670;4,4'-methanediylbis(1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one);Trichachnine; |
CAS: | 1251-85-0 |
EINECS: | 215-009-7 |
Molecular Formula: | C23H24N4O2 |
Molecular Weight: | 388.46226 |
InChI: | InChI=1S/C23H24N4O2/c1-16-20(22(28)26(24(16)3)18-11-7-5-8-12-18)15-21-17(2)25(4)27(23(21)29)19-13-9-6-10-14-19/h5-14H,15H2,1-4H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 212.5°C |
Boiling Point: | 515.2°Cat760mmHg |
Density: | 1.232g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Water Solubility: | negligible Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicity data (The |
Solubility: | negligible |
Appearance: | white crystalline powder |
Flash Point: | 212.5°C |
Safety Data |
|
|