Identification |
Name: | Benzoic acid,5-[bis[(2-hydroxyphenyl)methyl]amino]-2-hydroxy- |
Synonyms: | Lavendustin B; |
CAS: | 125697-91-8 |
Molecular Formula: | C21H19NO5 |
Molecular Weight: | 365.37926 |
InChI: | InChI=1S/C21H19NO5/c23-18-7-3-1-5-14(18)12-22(13-15-6-2-4-8-19(15)24)16-9-10-20(25)17(11-16)21(26)27/h1-11,23-25H,12-13H2,(H,26,27) |
Molecular Structure: |
|
Properties |
Density: | 1.423 g/cm3 |
Refractive index: | 1.726 |
Water Solubility: | Soluble in methanol, DMSO and dilute aqueous base. |
Solubility: | Soluble in methanol, DMSO and dilute aqueous base. |
Appearance: | Off-white solid. |
Safety Data |
|
|