Identification |
Name: | a-D-Galactopyranoside, ethyl1-thio-, 2,3,4,6-tetraacetate |
Synonyms: | a-D-Galactopyranoside, ethyl1-thio-, tetraacetate (9CI); Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-a-D-galactopyranoside |
CAS: | 126187-25-5 |
Molecular Formula: | C16H24 O9 S |
Molecular Weight: | 392.42 |
InChI: | InChI=1/C16H24O9S/c1-6-26-16-15(24-11(5)20)14(23-10(4)19)13(22-9(3)18)12(25-16)7-21-8(2)17/h12-16H,6-7H2,1-5H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 212.6°C |
Boiling Point: | 453.2°C at 760 mmHg |
Density: | 1.27g/cm3 |
Refractive index: | 1.501 |
Flash Point: | 212.6°C |
Usage: | A useful reagent for the preparation of galactosides |
Safety Data |
|
|