| Identification | |
| Name: | 1H-Inden-2-ol,1-amino-2,3-dihydro-, (1S,2R)- |
| Synonyms: | 1H-Inden-2-ol,1-amino-2,3-dihydro-, (1S-cis)-;(-)-cis-1-Aminoindan-2-ol;(1S)-Amino-(2R)-indanol;(1S,2R)-(-)-1-Amino-2-indanol;(1S,2R)-1-Amino-2,3-dihydro-1H-inden-2-ol;(1S,2R)-1-Aminoindan-2-ol;(1S-cis)-1-Amino-2-indanol;(2R-cis)-1-Amino-2,3-dihydro-1H-inden-2-ol;2(R)-Hydroxy-1(S)-aminoindane;[(1S,2R)-2-Hydroxy-2,3-dihydro-1H-inden-1-yl]amine;(1S,2R)-(+)-cis-1-Aminoindan-2-ol; |
| CAS: | 126456-43-7 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/p+1/t8-,9+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.212 g/cm3 |
| Alpha: | -62 o (C=0.5, CHCL3) |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?1H-Inden-2-ol,1-amino-2,3-dihydro-, (1S,2R)- , with CAS number of 126456-43-7, can be called (1S,2R)-(-)-Cis-1-amino-2-hydroxyindane ; (1s,2r)-(-)-cis-1-amino-2-indanol ; (1s,2r)-cis-1-amino-2-indanol ; (1s,2r)-(-)-cis-1-aminoindan-2-ol ; (1s,2r)-(+)-cis-1-aminoindan-2-ol ; (1s,2r)-1-amino-2,3-dihydro-1h-inden-2-ol ; (1s,2r)-(-)-1-amino-2-hydroxyindan ; (1s,2r)-1-amino-2-hydroxyindane . It is a white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
