| Identification | |
| Name: | Aroclor 1016 |
| Synonyms: | polychlorinated biphenyl mixture;3,3',5-trichlorobiphenyl |
| CAS: | 12674-11-2 |
| Molecular Formula: | C12H7Cl3 |
| Molecular Weight: | 257.543 |
| InChI: | InChI=1/C12H7Cl3/c13-10-3-1-2-8(4-10)9-5-11(14)7-12(15)6-9/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.7°C |
| Boiling Point: | 354.5°Cat760mmHg |
| Density: | 1.351g/cm3 |
| Refractive index: | 1.603 |
| Solubility: | IN WATER: 906 PPB 0.22-0.25 mg/l; 0.049 mg/l at 24 deg C composition of the water soluble fraction. In water: 0.085 ppm Water solubility at 25 deg C: 225-250 ug/l |
| Specification: |
Aroclor 1016 (CAS NO.12674-11-2) is a viscous oily liquid.It insoluble in water. Simple aromatic halogenated organic compounds are very unreactive. Reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. It is toxic irritant. Hazardous decomposition products. Some may burn but none ignite readily. Containers may explode when heated. Some may be transported hot. |
| Flash Point: | 245.7°C |
| Color: | ... Colorless mobile oil. |
| Safety Data | |
 |
|
