| Identification | |
| Name: | Cyclohexanecarboxamide,N-(2,3-dichloro-4-hydroxyphenyl)-1-methyl- |
| Synonyms: | Decree;Elevate; Fenhexamid; KBR 2738; Teldor |
| CAS: | 126833-17-8 |
| EINECS: | 422-530-5 |
| Molecular Formula: | C14H17 Cl2 N O2 |
| Molecular Weight: | 302.20 |
| InChI: | InChI=1/C14H17Cl2NO2/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15/h5-6,18H,2-4,7-8H2,1H3,(H,17,19) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 153 deg C |
| Flash Point: | 230.7°C |
| Boiling Point: | 457.9°Cat760mmHg |
| Density: | 1.338g/cm3 |
| Refractive index: | 1.604 |
| Solubility: | In water, 20 mg/L at 20 deg C |
| Specification: |
N-(2,3-Dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide with CAS number of 126833-17-8 is also known as N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide ; Fenhexamid ; Cyclohexanecarboxamide, N-(2,3-dichloro-4-hydroxyphenyl)-1-methyl- ; Fenhexamid standard ; Fenhexamid N-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid . This product shoud be storaged at 0-6°C. |
| Flash Point: | 230.7°C |
| Storage Temperature: | 0-6°C |
| Color: | White powder Solid |
| Safety Data | |
 |
|
