| Identification | |
| Name: | 1H-Pyrido[3',4':4,5]pyrrolo[3,2-c]quinoline-1,4(11H)-dione,3-methoxy- |
| Synonyms: | GH 32 |
| CAS: | 126983-60-6 |
| Molecular Formula: | C15H9 N3 O3 |
| Molecular Weight: | 279.27 |
| InChI: | InChI=1/C15H9N3O3/c1-21-11-4-10(19)12-13-8(6-17-14(12)15(11)20)7-5-16-3-2-9(7)18-13/h2-6,18H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 329.5°C |
| Boiling Point: | 621.2°Cat760mmHg |
| Density: | 1.55g/cm3 |
| Refractive index: | 1.765 |
| Specification: |
3-Methoxy-1H-pyrido(3',4':4,5)pyrrolo(3,2-c)quinoline-1,4(11H)-dione , its cas register number is 126983-60-6. It also can be called 3-Methoxy-11H-pyrido(3',4':4,5)pyrrolo(3,2-c)quinoline-1,4-dione ; 1H-Pyrido(3',4':4,5)pyrrolo(3,2-c)quinoline-1,4(11H)-dione, 3-methoxy- ; and GH32 . |
| Flash Point: | 329.5°C |
| Safety Data | |
 |
|
