| Identification |
| Name: | Pyruvic acid |
| Synonyms: | 2-Oxopropanoic acid; Pyruvic acid,(2-Oxopropionic acid); 2-Oxopropionic acid; 2-Ketopropionic acid |
| CAS: | 127-17-3 |
| EINECS: | 204-824-3 |
| Molecular Formula: | C3H4O3 |
| Molecular Weight: | 88.06 |
| InChI: | InChI=1/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8/PG 2 |
| Density: | 1.25 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. Refrigerate. |
| Refractive index: | 1.426-1.43 |
| Water Solubility: | complete |
| Solubility: | complete |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | II |
| HS Code: | 29335995 |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
