| Identification | |
| Name: | Perchlorethylene |
| Synonyms: | 1,1,2,2-Tetrachloroethylene; Ankilostin; tetralex; tetravec; Tetrochloroethane; tetroguer; Tetropil; antisol 1; Didakene; carbon dichloride; Dowper; Ethylene tetrachloride; fedal-un; Nema; PER; perawin; PERC; perchlor; Perchloroethylene; Perclene; Tetrachloroethylene; perclene d; percosolve; PERK; perklone; persec; tetlen; Tetracap; tetrachloroethene; tetraleno |
| CAS: | 127-18-4 |
| EINECS: | 204-825-9 |
| Molecular Formula: | C2Cl4 |
| Molecular Weight: | 165.83 |
| InChI: | InChI=1/C2Cl4/c3-1(4)2(5)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1897 |
| Density: | 1.625 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkali metals, aluminium, strong bases. |
| Refractive index: | 1.505 |
| Solubility: | < 0.1 mg/ml |
| Appearance: | colourless liquid with ether-like odour |
| Packinggroup: | III |
| HS Code: | 29032300 |
| Color: | Colorless liquid. |
| Usage: | Dry cleaning. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
