Identification |
Name: | 9-Octadecenoic acid(9Z)-, 1,1'-[1-[(dimethylamino)methyl]-1,2-ethanediyl] ester |
Synonyms: | 9-Octadecenoicacid (9Z)-, 1-[(dimethylamino)methyl]-1,2-ethanediyl ester (9CI);9-Octadecenoic acid (Z)-, 1-[(dimethylamino)methyl]-1,2-ethanediyl ester;1,2-Di(oleoyloxy)-3-(dimethylamino)propane; DODAP |
CAS: | 127512-29-2 |
Molecular Formula: | C41H77 N O4 |
Molecular Weight: | 648.05 |
InChI: | InChI=1/C41H77NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(43)45-38-39(37-42(3)4)46-41(44)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,39H,5-18,23-38H2,1-4H3/b21-19-,22-20- |
Molecular Structure: |
![(C41H77NO4) 9-Octadecenoicacid (9Z)-, 1-[(dimethylamino)methyl]-1,2-ethanediyl ester (9CI);9-Octadecenoic acid (...](https://img1.guidechem.com/chem/e/dict/26/127512-29-2.jpg) |
Properties |
Flash Point: | 359.092°C |
Boiling Point: | 670.148°C at 760 mmHg |
Density: | 0.916g/cm3 |
Refractive index: | 1.476 |
Flash Point: | 359.092°C |
Usage: | Cationic amphiphiles are being studied for their potential role in preparing liposomes for interaction with artificial and biological membranes and cellular transfection techniques. Cationic species with ester linkages to the hydrophobic portion ar |
Safety Data |
|
 |