| Identification | |
| Name: | Phenol,3-methyl-5-nitro- |
| Synonyms: | m-Cresol,5-nitro- (1CI,3CI);NSC 41202;3-Methyl-5-nitrophenol; |
| CAS: | 127818-58-0 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.13 |
| InChI: | InChI=1/C7H7NO3/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.32 g/cm3 |
| Refractive index: | 1.596 |
| Specification: |
The 3-Methyl-5-nitrophenol with the cas number 127818-58-0 is also called Phenol,3-methyl-5-nitro-. Its molecular formula is C7H7NO3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.39; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 4; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 55.05 Å2; (7)Index of Refraction: 1.596; (8)Molar Refractivity: 39.5 cm3; (9)Molar Volume: 115.9 cm3; (10)Polarizability: 15.66×10-24cm3; (11)Surface Tension: 54.7 dyne/cm; (12)Enthalpy of Vaporization: 55.68 kJ/mol; (13)Vapour Pressure: 0.000853 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
