| Identification | |
| Name: | Benzonitrile,3-[(1R)-1-aminoethyl]- |
| Synonyms: | Benzonitrile,3-(1-aminoethyl)-, (R)-;(1R)-1-(3-Cyanophenyl)ethanamine;(R)-1-(3-Cyanophenyl)ethylamine;(R)-3-(1-Aminoethyl)benzonitrile; |
| CAS: | 127852-31-7 |
| Molecular Formula: | C9H10N2 |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C9H10N2/c1-7(11)9-4-2-3-8(5-9)6-10/h2-5,7H,11H2,1H3/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.06 g/cm3 |
| Refractive index: | 1.557 |
| Appearance: | White solid |
| Specification: |
The (R)-3-(1-Aminoethyl)benzonitrile with the CAS number 127852-31-7 is also called Benzonitrile,3-[(1R)-1-aminoethyl]-. The systematic name is 3-[(1R)-1-aminoethyl]benzonitrile. Its molecular formula is C9H10N2. The product's category is API intermediates. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.87; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 49.81Å2; (11)Index of Refraction: 1.557; (12)Molar Refractivity: 44.17 cm3; (13)Molar Volume: 137.1 cm3; (14)Polarizability: 17.51×10-24cm3; (15)Surface Tension: 46.9 dyne/cm; (16)Enthalpy of Vaporization: 48.87 kJ/mol; (17)Vapour Pressure: 0.0206 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
