| Identification | |
| Name: | N-Ethyl-N-ethoxylethyl-4-amino-2-methyl benzaldehyde |
| CAS: | 128237-47-8 |
| Molecular Formula: | C14H21NO2 |
| Molecular Weight: | 235.33 |
| InChI: | InChI=1/C14H21NO2/c1-4-15(8-9-17-5-2)14-7-6-13(11-16)12(3)10-14/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| Molecular Structure: | ![(C14H21NO2) 2-Methyl-4-[N-ethyl-N-(β-ethoxy)ethyl]aminobenzaldehyde;](https://img.guidechem.com/casimg/128237-47-8.gif) |
| Properties | |
| Flash Point: | 174.8°C |
| Boiling Point: | 365.4°C at 760 mmHg |
| Density: | 1.033g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
The N-Ethyl-N-ethoxylethyl-4-amino-2-methyl benzaldehyde with the cas number 128237-47-8 is also called 2-Methyl-4-[N-ethyl-N-(β-ethoxy)ethyl]aminobenzaldehyde .The N-Ethyl-N-ethoxylethyl-4-amino-2-methyl benzaldehyde can be used as dyestuff intermediate.This product can bye supplied by the following suppliers: (1)Wenzhou Longsheng Chemical Co., Ltd.; (2)Shanghai Unichem International Trade Ltd. ; (3)Link Chemicals Co.,Ltd.; (4)Hangzhou Sunny Chemical Co., Ltd.; (5)Nanjing Chemlin Chemical Co., Ltd. ; (6)Leap Labchem Co.,Ltd.; (7)BETAPHARMA (SHANGHAI) CO., LTD.. |
| Flash Point: | 174.8°C |
| Safety Data | |
 |
|
