| Identification | |
| Name: | 1,9-Pyrazoloanthrone |
| Synonyms: | Anthra[1,9-cd]pyrazol-6(2H)-one;1PMV;2H-Dibenzo[cd,g]indazol-6-one;C.I. 70300;NSC 75890;Pyrazolanthrone;Pyrazoleanthrone;SP 600125; |
| CAS: | 129-56-6 |
| EINECS: | 204-955-6 |
| Molecular Formula: | C14H8N2O |
| Molecular Weight: | 220.22612 |
| InChI: | InChI=1S/C14H8N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7H,(H,15,16) |
| Molecular Structure: | ![(C14H8N2O) Anthra[1,9-cd]pyrazol-6(2H)-one;1PMV;2H-Dibenzo[cd,g]indazol-6-one;C.I. 70300;NSC 75890;Pyrazolanthr...](https://img1.guidechem.com/chem/e/dict/39/129-56-6.jpg) |
| Properties | |
| Density: | 1.463 g/cm3 |
| Refractive index: | 1.799 |
| Water Solubility: | H2O: insoluble |
| Solubility: | H2O: insoluble |
| Appearance: | yellow |
| Report: |
Reported in EPA TSCA Inventory. |
| Biological Activity: | Selective inhibitor of c-Jun N-terminal kinase (JNK). Competitively and reversibly inhibits JNK1, 2 and 3 (IC 50 = 40-90 nM) with negligible activity at ERK2, p38 β and a range of enzymes (IC 50 > 10 μ M). Active in vivo . Shown to have reduced selectivity over other protein kinases under certain conditions. Protects renal tubular epithelial cells against ischemia/reperfusion-induced apoptosis. Also available as part of the MAPK Inhibitor Tocriset™ . |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
