| Identification | |
| Name: | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylicacid, sodium salt (1:2) |
| Synonyms: | 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylicacid, disodium salt (6CI,8CI,9CI); Aguathol; Disodium3,6-epoxycyclohexane-1,2-dicarboxylate; Disodium7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate; Disodium endothallate; Endothaldisodium salt; Endothal-sodium |
| CAS: | 129-67-9 |
| EINECS: | 204-959-8 |
| Molecular Formula: | C8H10 O5 . 2 Na |
| Molecular Weight: | 230.14 |
| InChI: | InChI=1/C8H10O5.2Na/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-6H,1-2H2,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| Molecular Structure: | ![(C8H10O5.2Na) 7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylicacid, disodium salt (6CI,8CI,9CI); Aguathol; Disodium3,6-...](https://img1.guidechem.com/chem/e/dict/23/129-67-9.jpg) |
| Properties | |
| Melting Point: | Converted to anhydride at 90 deg C |
| Flash Point: | 190.5°C |
| Boiling Point: | 447.8°C at 760 mmHg |
| Solubility: | Solubility at 20 deg C, g/100 g: acetone 7.0, benzene 0.01, dioxane 7.6, ether 0.1, isopropanol 1.7, methanol 28.0, water 10.0 In water 100,000 mg/L at 20 deg C |
| Specification: |
Disodium-3,6-endoxohexahydro-phthalate (CAS NO.129-67-9) is also called (3,6-Epossi-cicloesan-1,2-dicarbossilato) disodico [Italian] ; 3,6-Endoxohexahydrophthalic acid disodium salt ; 3,6-Epoxy-cyclohexane 1,2-carboxylate disodique [French] ; 7-Oxabicyclo(2.2.1)heptane-2,3-dicarboxylic acid disodium salt ; AI3-26430 ; Accelerate ; Aguathol ; Dinatrium-(3,6-epoxy-cyclohexaan-1,2-dicarboxylaat) [Dutch] ; Dinatrium-(3,6-epoxy-cyclohexan-1,2-dicarboxylat) [German] ; Disodium 3,6-epoxycyclohexane-1,2-dicarboxylate ; Disodium 7-oxabicyclo(2.2.1)heptane-2,3-dicarboxylate ; Disodium endothall ; Endothal-disodium ; Endothal-natrium [Dutch] ; Endothal-sodium [ISO] ; Endothall disodium salt .Disodium-3,6-endoxohexahydro-phthalate (CAS NO.129-67-9) is a kind of pesticides. It is high toxic. So the storage environment should be ventilate, low-temperature and dry. Keep Disodium-3,6-endoxohexahydro-phthalate (CAS NO.129-67-9) separate from raw materials of food. |
| Flash Point: | 190.5°C |
| Color: | Cyrstalline, white solid |
| Safety Data | |
 |
|
