Identification |
Name: | 1H-Imidazo[4,5-b]pyridine,1-methyl-2-nitro-6-phenyl- |
Synonyms: | 2-nitro-1-methyl-6-phenylimidazo(4,5-b)pyridine |
CAS: | 129018-59-3 |
Molecular Formula: | C13H10 N4 O2 |
Molecular Weight: | 254.2441 |
InChI: | InChI=1/C13H10N4O2/c1-16-11-7-10(9-5-3-2-4-6-9)8-14-12(11)15-13(16)17(18)19/h2-8H,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 259°C |
Boiling Point: | 504.6°Cat760mmHg |
Density: | 1.4g/cm3 |
Refractive index: | 1.704 |
Flash Point: | 259°C |
Usage: | Shows potent mutagenic activity in the reversion assay of Salmonella typhimurium |
Safety Data |
|
 |