| Identification | |
| Name: | MP-2000 |
| Synonyms: | 1,4-Benzenedicarboxaldehyde, polymer with benzenamine and 2-methylbenzenamine, maleated;Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride |
| CAS: | 129217-90-9 |
| EINECS: | 406-620-1 |
| Molecular Formula: | C21H22N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H6O2.C7H9N.C6H7N/c9-5-7-1-2-8(6-10)4-3-7;1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6/h1-6H;2-5H,8H2,1H3;1-5H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101.7°C |
| Boiling Point: | 246.5°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
MP-2000 (CAS NO.129217-90-9) is also called 1,4-Benzenedicarboxaldehyde, polymer with benzenamine and 2-methylbenzenamine, maleated ; 1,4-Benzenedicarboxaldehyde, polymer with benzeneamine and 2-methylbenzeneamine, maleated . |
| Flash Point: | 101.7°C |
| Safety Data | |
 |
|
