| Identification | |
| Name: | 3,6-Octanediol,(3R,6R)- |
| Synonyms: | (3R,6R)Dihydroxyoctane |
| CAS: | 129619-37-0 |
| Molecular Formula: | C8H18O2 |
| Molecular Weight: | 146.22732 |
| InChI: | InChI=1S/C8H18O2/c1-3-7(9)5-6-8(10)4-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.935 g/cm3 |
| Refractive index: | 1.45 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | colorless xtl. |
| Specification: |
(3R,6R)-3,6-Octanediol (129619-37-0) is a chiral compound with appearance of off-white needle-like crystal. It is also known as (3R,6R)-Dihydroxyoctane ; (3R,6R)-Octane-3,6-diol ; (3R,6R)-3,6-Dihydroxyoctane ; (3R,6R)-(-)-3,6-Octanediol ; (3R,6R)-(-)-3,6-Octanediol , 99% ; (3R,6R)-3,6-Octanediol, 95%, (98% ee) . |
| Safety Data | |
 |
|
