| Identification | |
| Name: | Benz[cd]indol-2(1H)-one |
| Synonyms: | Naphthostyril(6CI,7CI);1,8-Naphtholactam;2(1H)-Perinaphthazolone;2(1H)-peri-Naphthazolone;Naphtholactam; |
| CAS: | 130-00-7 |
| EINECS: | 204-973-4 |
| Molecular Formula: | C11H7NO |
| Molecular Weight: | 169.18 |
| InChI: | InChI=1/C11H7NO/c13-11-8-5-1-3-7-4-2-6-9(12-11)10(7)8/h1-6H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.327 g/cm3 |
| Refractive index: | 1.723 |
| Appearance: | light yellow powder |
| Specification: |
Benz[cd]indol-2(1H)-one , with CAS number of 130-00-7, can be called 1-Naphthalenecarboxylic acid, 8-amino-, lactam ; 1,8-Naphtholactam ; Naphtholactam ; Naftostiril . Benz[cd]indol-2(1H)-one (CAS NO.130-00-7) is mainly used as intermediate for the synthesis of vat dyes and organic pigments. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
