| Identification | |
| Name: | 5-Chloro-8-hydroxy-7-iodoquinoline |
| Synonyms: | 5-Chloro-7-iodo-8-hydroxyquinoline; Clioquinol; 5-Chloro-7-iodoquinolin-8-ol; Iodochlorohydroxyquin |
| CAS: | 130-26-7 |
| EINECS: | 204-984-4 |
| Molecular Formula: | C9H5ClINO |
| Molecular Weight: | 305.5 |
| InChI: | InChI=1/C9H5ClINO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 2.047g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.753 |
| Solubility: | Insoluble |
| Appearance: | Cream-colored to brownish-yellow powder. Practically odorless. |
| Packinggroup: | III |
| Color: | Brownish-yellow, bulky powder Yellow brown needles from alcohol, acetic acid. A voluminous, spongy, yellowish to white brownish powder |
| Usage: | Antiseptic. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
