| Identification | |
| Name: | 9H-Carbazol-3-ol,6-amino-5,8-dimethyl- |
| Synonyms: | 1,4-Dimethyl-6-hydroxy-3-aminocarbazole;6-Amino-5,8-dimethyl-9H-carbazol-3-ol; NSC 652570 |
| CAS: | 130005-62-8 |
| Molecular Formula: | C14H14 N2 O |
| Molecular Weight: | 226.30 |
| InChI: | InChI=1/C14H14N2O/c1-7-5-11(15)8(2)13-10-6-9(17)3-4-12(10)16-14(7)13/h3-6,16-17H,15H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 265.3°C |
| Boiling Point: | 515.1°Cat760mmHg |
| Density: | 1.336g/cm3 |
| Refractive index: | 1.796 |
| Specification: |
6-Amino-5,8-dimethyl-9H-carbazol-3-ol , its cas register number is 130005-62-8. It also can be called 1,4-Dimethyl-6-hydroxy-3-aminocarbazole ; CCRIS 8648 . When 6-Amino-5,8-dimethyl-9H-carbazol-3-ol (CAS NO.130005-62-8) is heated to decomposition, it emits toxic vapors of NOx. |
| Flash Point: | 265.3°C |
| Safety Data | |
 |
|
