Identification |
Name: | Benzonitrile, 2-(2-(4-(2-(4-cyanophenyl)ethenyl)phenyl)ethenyl)- |
Synonyms: | Benzonitrile,2,4'-(p-phenylenedivinylene)di- (7CI,8CI); |
CAS: | 13001-38-2 |
EINECS: | 235-834-6 |
Molecular Formula: | C24H16N2 |
Molecular Weight: | 332.4 |
InChI: | InChI=1/C24H16N2/c25-17-23-7-3-1-5-21(23)15-13-19-9-11-20(12-10-19)14-16-22-6-2-4-8-24(22)18-26/h1-16H/b15-13+,16-14+ |
Molecular Structure: |
 |
Properties |
Density: | 1.18 g/cm3 |
Refractive index: | 1.66 |
Water Solubility: | insoluble |
Solubility: | Insoluble in water |
Appearance: | Greenish yellow crystalline powder |
Specification: |
Benzonitrile, 2-(2-(4-(2-(4-cyanophenyl)ethenyl)phenyl)ethenyl)- , with CAS number of 13001-38-2, can be called 2-(2-(4-(2-(4-Cyanophenyl)vinyl)phenyl)vinyl)benzonitrile .
|
Safety Data |
|
 |