| Identification | |
| Name: | Sodium Tetraborate Decahydrate |
| Synonyms: | Sodium borate; Sodium tetraborate,decahydrate; Borax; Disodium tetraborate; Borax,medicinal |
| CAS: | 1303-96-4 |
| EINECS: | 215-540-4 |
| Molecular Formula: | Na2B4O7?10(H2O) |
| Molecular Weight: | 381.37 |
| InChI: | InChI=1/B4O7.2Na/c5-1-9-3(7)11-4(8)10-2-6;;/q-2;2*+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1458 |
| Density: | 1.73 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Soluble |
| Appearance: | Colourless to grey-white crystals or powder |
| Specification: |
?Synonyms of?Borax (CAS NO.1303-96-4) are Borax (B4Na2O7.10H2O) ;?Borax (Na2(B4O7).10H2O) ;?Sodium borate, decahydrate ;?Sodium tetraborate decahydrate ;?Borates, tetra, sodium salts, decahydrate ;?Sodium borate ;?Sodium tetraborate |
| HS Code: | 28401990 |
| Storage Temperature: | Store at RT. |
| Usage: | As preservative, either alone or with other antiseptics against wood fungus, artificial aging of wood, fireproofing fabrics & woods, soldering metals, manufacture of glazes & enamels, curing & preserving skins, tanning, pharmaceutic aid (alkalizing agent) vet: antiseptic, detergent, astringent for mucous membranes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
