| Identification | |
| Name: | Nitromethane-d3 |
| Synonyms: | Nitromethanedisotopicpurity |
| CAS: | 13031-32-8 |
| EINECS: | 235-892-2 |
| Molecular Formula: | [2H]3CNO2 |
| Molecular Weight: | 64.05 |
| InChI: | InChI=1/CH3NO2/c1-2(3)4/h1H3/i1D3 |
| Molecular Structure: | ![([2H]3CNO2) Nitromethanedisotopicpurity](https://img.guidechem.com/casimg/13031-32-8.gif) |
| Properties | |
| Transport: | UN 1261 3/PG 2 |
| Density: | 1.18 |
| Stability: | May detonate if sensitized by amines, alkalies, strong acids, high temperatures or adiabatic compression. The dry alkali or amine salts are shock-sensitive and the sodium salt ignites on contact with water. Flammable. Incompatible with amines, strong acids, strong bases, strong oxidizing agents, strong reducing agents, copper, copper alloys, |
| Refractive index: | n20/D 1.3795(lit.) |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
