Identification |
Name: | beta-D-Ribofuranose 1,2,3,5-tetraacetate |
CAS: | 13035-61-5 |
EINECS: | 235-898-5 |
Molecular Formula: | C13H18O9 |
Molecular Weight: | 318.28 |
InChI: | InChI=1/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
Molecular Structure: |
 |
Properties |
Transport: | 40kgs |
Density: | 1.29g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Alpha: | -15.4 o (C=7, MEOH) |
Solubility: | Very soluble |
Appearance: | White to Yellowish Crystal |
Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
|
|
 |