| Identification |
| Name: | beta-D-Ribofuranose 1,2,3,5-tetraacetate |
| CAS: | 13035-61-5 |
| EINECS: | 235-898-5 |
| Molecular Formula: | C13H18O9 |
| Molecular Weight: | 318.28 |
| InChI: | InChI=1/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11-,12-,13-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 40kgs |
| Density: | 1.29g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -15.4 o (C=7, MEOH) |
| Solubility: | Very soluble |
| Appearance: | White to Yellowish Crystal |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
