Identification |
Name: | Acetic acid,2-[[[(4-bromo-3-chlorophenyl)amino]thioxomethyl]thio]- |
Synonyms: | Aceticacid, [[[(4-bromo-3-chlorophenyl)amino]thioxomethyl]thio]- (9CI); Carbanilic acid,4-bromo-3-chlorodithio-, ester with mercaptoacetic acid (7CI); Carbanilic acid,4-bromo-3-chlorodithio-, ester with mercaptoacetic acid (8CI) |
CAS: | 13037-49-5 |
Molecular Formula: | C9H7 Br Cl N O2 S2 |
Molecular Weight: | 340.6444 |
InChI: | InChI=1S/C9H7BrClNO2S2/c10-6-2-1-5(3-7(6)11)12-9(15)16-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14) |
Molecular Structure: |
![(C9H7BrClNO2S2) Aceticacid, [[[(4-bromo-3-chlorophenyl)amino]thioxomethyl]thio]- (9CI); Carbanilic acid,4-bromo-3-ch...](https://img1.guidechem.com/chem/e/dict/2/13037-49-5.jpg) |
Properties |
Flash Point: | 232.6°C |
Boiling Point: | 460.9°Cat760mmHg |
Density: | 1.855g/cm3 |
Flash Point: | 232.6°C |
Safety Data |
|
 |