| Identification | |
| Name: | Phenol, 4-(heptyloxy)- |
| Synonyms: | Phenol,p-(heptyloxy)- (7CI,8CI);p-(Heptyloxy)phenol;p-Heptoxyphenol; |
| CAS: | 13037-86-0 |
| EINECS: | 206-736-0 |
| Molecular Formula: | C13H20O2 |
| Molecular Weight: | 208.3 |
| InChI: | InChI=1/C13H20O2/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10,14H,2-6,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.8°C |
| Boiling Point: | 325.3°Cat760mmHg |
| Density: | 0.987g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.505 |
| Solubility: | Insoluble |
| Appearance: | Off-white powder. |
| Specification: |
Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Biological Activity: | Selective inverse agonist at the orphan nuclear receptor steroidogenic factor-1 (SF-1) (IC 50 = 50-100 nM).? Displays no activity at estrogen, LRH-1, ROR, ERR or Nurr receptors. Inhibits SFRE-mediated transcription. |
| Flash Point: | 144.8°C |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
