| Identification | |
| Name: | 3-Pyrazolidinone,4-(hydroxymethyl)-4-methyl-1-phenyl- |
| Synonyms: | 1-Phenyl-4-(hydroxymethyl)-4-methyl-3-pyrazolidone;1-Phenyl-4-methyl-4-(hydroxymethyl)-3-pyrazolidinone;1-Phenyl-4-methyl-4-(hydroxymethyl)-3-pyrazolidone;4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidinone;4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidone;Dimezone S; |
| CAS: | 13047-13-7 |
| EINECS: | 235-920-3 |
| Molecular Formula: | C11H14 N2 O2 |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C11H14N2O2/c1-11(8-14)7-13(12-10(11)15)9-5-3-2-4-6-9/h2-6,14H,7-8H2,1H3,(H,12,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.188 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.56 |
| Solubility: | 7.1 g/L (20 ºC) in water |
| Appearance: | Yellow powder. |
| Specification: |
Dimezone S (CAS NO.13047-13-7) is also named as 1-Phenyl-4-methyl-4-hydroxymethyl-3-pyrazolidone ; 3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl- ; 4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidinone ; 4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidone ; 3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl- 4-(Hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one . Dimezone S (CAS NO.13047-13-7) is cream to yellow crystalline powder. |
| Flash Point: | °C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Photographic film developer. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
