| Identification |
| Name: | 1,6-Hexanediol diacrylate |
| Synonyms: | 2-Propenoic acid, 1,6-hexanediyl ester; HDDA; Hexamethylene diacrylate; |
| CAS: | 13048-33-4 |
| EINECS: | 235-921-9 |
| Molecular Formula: | C12H18O4 |
| Molecular Weight: | 226.27 |
| InChI: | InChI=1/C12H18O4/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2/h3-4H,1-2,5-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Density: | 1.01 |
| Stability: | No data. |
| Refractive index: | 1.456 |
| Solubility: | Insoluble |
| Appearance: | Clear yellow liquid. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Hygroscopic |
| Usage: | Crosslinking agent for uv-curable polymers, eg, coatings. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
