| Identification | |
| Name: | Propanoic acid,anhydride with acetic acid |
| Synonyms: | Propionicacid, anhydride with AcOH (6CI,7CI); Propionic acid, anhydride with acetic acid(8CI); Acetic acid, anhydride with propionic acid (8CI); Acetic propionicanhydride; Acetyl propionate |
| CAS: | 13080-96-1 |
| Molecular Formula: | C5H8 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H8O3/c1-3-5(7)8-4(2)6/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1760 |
| Flash Point: | 63.5°C |
| Boiling Point: | 154.1°C at 760 mmHg |
| Density: | 1.039g/cm3 |
| Refractive index: | 1.399 |
| Packinggroup: | III |
| Flash Point: | 63.5°C |
| Safety Data | |
 |
|
