Identification |
Name: | 2-Propenamide,2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-, (2E)- |
Synonyms: | Entacom;OR 611;2-Propenamide,2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethyl-, (E)-;(E)-Entacapone;Comtan; |
CAS: | 130929-57-6 |
Molecular Formula: | C14H15N3O5 |
Molecular Weight: | 305.29 |
InChI: | InChI=1/C14H15N3O5/c1-3-16(4-2)14(20)10(8-15)5-9-6-11(17(21)22)13(19)12(18)7-9/h5-7,18-19H,3-4H2,1-2H3/b10-5+ |
Molecular Structure: |
|
Properties |
Melting Point: | 162-163ºC |
Flash Point: | 272.3 ºC |
Boiling Point: | 526.6 ºC |
Density: | 1.392 g/cm3 |
Appearance: | yellow powder |
Flash Point: | 272.3 ºC |
Usage: | (E)-Isomer of Entacapone polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian |
Safety Data |
|
|