| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 1,2-dipropyl ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, dipropyl ester (9CI);Phthalic acid, dipropyl ester (6CI,7CI,8CI);Di-n-Propyl phthalate;Dipropyl benzene-1,2-dicarboxylate;NSC 15314; |
| CAS: | 131-16-8 |
| EINECS: | 205-015-8 |
| Molecular Formula: | C14H18O4 |
| Molecular Weight: | 250.2938 |
| InChI: | InChI=1/C14H18O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h5-8H,3-4,9-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9 |
| Refractive index: | n20/D 1.497(lit.) |
| Appearance: | clear colorless liquid |
| Specification: |
It is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
