| Identification | |
| Name: | A-naphthyl red hydrochloride |
| Synonyms: | 4-Phenylazo-1-naphthylamine |
| CAS: | 131-22-6 |
| EINECS: | 205-018-4 |
| Molecular Formula: | C16H13N3.HCl |
| Molecular Weight: | 283.76 |
| InChI: | InChI=1/C16H13N3/c17-15-10-11-16(14-9-5-4-8-13(14)15)19-18-12-6-2-1-3-7-12/h1-11H,17H2/b19-18+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 226.8°C |
| Boiling Point: | 451.4°Cat760mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.647 |
| Specification: |
4-Phenylazo-1-naphthylamine (CAS NO.131-22-6) is also called 1-Amino-4-phenylazonaphthalene ; 1-Naphthalenamine, 4-(phenylazo)- ; 1-Naphthylamine, 4-(phenylazo)- ; 4-[(E)-Phenyldiazenyl]-1-naphthalenamine ; 4-Benzeneazo-1-naphthylamine ; 4-Benzene-azo-alpha-naphthylamine ; BNA . 4-Phenylazo-1-naphthylamine (CAS NO.131-22-6) do not dissolve in water, but rendering the red-brown solution soluble in alcohol, ether and benzene. And It slightly soluble in diluted acid solution rendering a red rose solution. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 226.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
