| Identification | |
| Name: | Oxybenzone |
| Synonyms: | Ultraviolet absorbent UV-9;2-Hydroxy-4-methoxy benzophenone(UV9);Uvinul 9;Sunscreen UV-15;UV 9;2-Hydroxy-4-methoxybenzophenone;Usaf cy-9;Aduvex 24;MOB;UF 3;ASL 24;Oxybenzon;Methanone,(2-hydroxy-4-methoxyphenyl)- phenyl-;Benzophenone, 2-hydroxy-4-methoxy-;Ongrostab HMB;Chimassorb 90;4-Methoxy-2-hydroxybenzophenone;Advastab 45;Sumisorb 110;Seesorb 101;Oxybenzone,131-57-7;UV-9 / BP-3;Methanone, (2-hydroxy-4-methoxyphenyl)phenyl-;2-hydroxyl-4-methylbenzophenone; |
| CAS: | 131-57-7 |
| EINECS: | 205-031-5 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.25 |
| InChI: | InChI=1/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.5 oC |
| Density: | 1.324 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.595 |
| Solubility: | <0.1 g/100 mL at 20 oC in water |
| Appearance: | White to off-white or light yellow powder. |
| Packinggroup: | II; III |
| HS Code: | 29145000 |
| Flash Point: | 140.5 oC |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless crystals |
| Usage: | Sunscreen agent. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
