| Identification | |
| Name: | Phenol,2,4,6-trinitro-, ammonium salt (1:1) |
| Synonyms: | Obelinepicrate (6CI); Phenol, 2,4,6-trinitro-, ammonium salt (9CI); Picric acid,ammonium salt (7CI,8CI); Ammonium picrate; Explosive D; Picratol |
| CAS: | 131-74-8 |
| EINECS: | 205-038-3 |
| Molecular Formula: | C6H3 N3 O7 . H3 N |
| Molecular Weight: | 246.16 |
| InChI: | InChI=1/C6H3N3O7.H3N/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 0004 |
| Flash Point: | 133.9°C |
| Boiling Point: | 303.6°Cat760mmHg |
| Density: | 1.856g/cm3 |
| Solubility: | 1 g in 78 ml water @ 25 deg C, 15 ml boiling water, 12 ml alcohol, 10 ml benzene, 35 ml chloroform, and 65 ml ether Soluble in ethanol and ether, very soluble in acetone In water, 1.27X10+4 mg/l @ 25 deg C |
| Packinggroup: | II |
| Flash Point: | 133.9°C |
| Color: | Yellow crystals Yellow ... solid [Note: Usually used as an aqeous solution]. |
| Safety Data | |
| Hazard Symbols | |
 |
|
