| Identification |
| Name: | 1-Nitroso-2-naphthol |
| Synonyms: | 1-nitroso-2-naphthol (alpha-beta) |
| CAS: | 131-91-9 |
| EINECS: | 205-043-0 |
| Molecular Formula: | C10H7NO2 |
| Molecular Weight: | 173.17 |
| InChI: | InChI=1/C10H7NO2/c12-9-6-5-7-3-1-2-4-8(7)10(9)11-13/h1-6,12H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN3077 |
| Density: | 1.27 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | tan to brown / crystalline |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | tan to brown |
| Usage: | To prevent gum formation in gasoline. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
