| Identification |
| Name: | 2-Quinolinecarboxylicacid, 5,7-dichloro-4-hydroxy- |
| Synonyms: | Kynurenicacid, 5,7-dichloro- (4CI);5,7-Dichlorokynurenic acid; |
| CAS: | 131123-76-7 |
| Molecular Formula: | C10H5Cl2NO3 |
| Molecular Weight: | 280.04 |
| InChI: | InChI=1/C10H5Cl2NO3/c11-4-1-5(12)9-6(2-4)13-7(10(15)16)3-8(9)14/h1-3H,(H,13,14)(H,15,16) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 212.8°C |
| Boiling Point: | 428.3°Cat760mmHg |
| Density: | 1.651g/cm3 |
| Refractive index: | 1.656 |
| Biological Activity: | Potent antagonist at the glycine site of the NMDA receptor (K i = 79 nM vs. [ 3 H]-glycine). |
| Flash Point: | 212.8°C |
| Color: | light yellow |
| Safety Data |
| |
 |
