| Identification | |
| Name: | Hydrazine,(4-iodophenyl)- |
| Synonyms: | Hydrazine,(p-iodophenyl)- (8CI); 1-(4-Iodophenyl)hydrazine; 4-Iodophenylhydrazine;p-Iodophenylhydrazine |
| CAS: | 13116-27-3 |
| Molecular Formula: | C6H7 I N2 |
| Molecular Weight: | 234.03 |
| InChI: | InChI=1/C6H7IN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 138.1°C |
| Boiling Point: | 304.8°Cat760mmHg |
| Density: | 1.981g/cm3 |
| Refractive index: | 1.74 |
| Specification: |
4-Iodophenylhydrazine with cas registry number of 13116-27-3 is also called 1-(4-Iodophenyl)hydrazine with chemical property of white to orange-brown crystalline powder. |
| Packinggroup: | III |
| Flash Point: | 138.1°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
